C8H17N3 — CID 123196625
1-N,2-N-dimethyl-3-methyliminopent-4-ene-1,2-diamine (PubChem CID 123196625) has the molecular formula C8H17N3 and a molecular weight of 155.24 g/mol. Its IUPAC name is 1-N,2-N-dimethyl-3-methyliminopent-4-ene-1,2-diamine.
| Compound Name | 1-N,2-N-dimethyl-3-methyliminopent-4-ene-1,2-diamine |
|---|---|
| PubChem CID | 123196625 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 1-N,2-N-dimethyl-3-methyliminopent-4-ene-1,2-diamine |
| SMILES | C=C/C(=N\C)C(CNC)NC |
| InChI | InChI=1S/C8H17N3/c1-5-7(10-3)8(11-4)6-9-2/h5,8-9,11H,1,6H2,2-4H3/b10-7+ |
| InChIKey | JZKGPTMEQSKHHV-JXMROGBWSA-N |
| XLogP | 0.05 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|