C25H29N5O4 — CID 143117210
[1-(3,4-diamino-5-methylphenyl)-3-oxopropan-2-yl] 4-(2-oxo-5-phenyl-1H-imidazol-3-yl)piperidine-1-carboxylate (PubChem CID 143117210) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is [1-(3,4-diamino-5-methylphenyl)-3-oxopropan-2-yl] 4-(2-oxo-5-phenyl-1H-imidazol-3-yl)piperidine-1-carboxylate.
| Compound Name | [1-(3,4-diamino-5-methylphenyl)-3-oxopropan-2-yl] 4-(2-oxo-5-phenyl-1H-imidazol-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143117210 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | [1-(3,4-diamino-5-methylphenyl)-3-oxopropan-2-yl] 4-(2-oxo-5-phenyl-1H-imidazol-3-yl)piperidine-1-carboxylate |
| SMILES | Cc1cc(CC(C=O)OC(=O)N2CCC(n3cc(-c4ccccc4)[nH]c3=O)CC2)cc(N)c1N |
| InChI | InChI=1S/C25H29N5O4/c1-16-11-17(13-21(26)23(16)27)12-20(15-31)34-25(33)29-9-7-19(8-10-29)30-14-22(28-24(30)32)18-5-3-2-4-6-18/h2-6,11,13-15,19-20H,7-10,12,26-27H2,1H3,(H,28,32) |
| InChIKey | MQZUDWPYLQZQSZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 136.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|