C20H24 — CID 143117324
1-[4-(cyclopenten-1-yl)-5-prop-2-enylcyclopenten-1-yl]-4-methylbenzene (PubChem CID 143117324) has the molecular formula C20H24 and a molecular weight of 264.41 g/mol. Its IUPAC name is 1-[4-(cyclopenten-1-yl)-5-prop-2-enylcyclopenten-1-yl]-4-methylbenzene.
| Compound Name | 1-[4-(cyclopenten-1-yl)-5-prop-2-enylcyclopenten-1-yl]-4-methylbenzene |
|---|---|
| PubChem CID | 143117324 |
| Molecular Formula | C20H24 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 1-[4-(cyclopenten-1-yl)-5-prop-2-enylcyclopenten-1-yl]-4-methylbenzene |
| SMILES | C=CCC1C(c2ccc(C)cc2)=CCC1C1=CCCC1 |
| InChI | InChI=1S/C20H24/c1-3-6-20-18(16-7-4-5-8-16)13-14-19(20)17-11-9-15(2)10-12-17/h3,7,9-12,14,18,20H,1,4-6,8,13H2,2H3 |
| InChIKey | LGXHYOSYYIODJK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|