C30H40FNO2 — CID 143118558
methyl 6-[[4-[(3E,5E)-3,6-dimethyldeca-3,5-dienyl]phenyl]methyl-ethylamino]-3-fluorocyclohepta-1,4,6-triene-1-carboxylate (PubChem CID 143118558) has the molecular formula C30H40FNO2 and a molecular weight of 465.65 g/mol. Its IUPAC name is methyl 6-[[4-[(3E,5E)-3,6-dimethyldeca-3,5-dienyl]phenyl]methyl-ethylamino]-3-fluorocyclohepta-1,4,6-triene-1-carboxylate.
| Compound Name | methyl 6-[[4-[(3E,5E)-3,6-dimethyldeca-3,5-dienyl]phenyl]methyl-ethylamino]-3-fluorocyclohepta-1,4,6-triene-1-carboxylate |
|---|---|
| PubChem CID | 143118558 |
| Molecular Formula | C30H40FNO2 |
| Molecular Weight | 465.65 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | methyl 6-[[4-[(3E,5E)-3,6-dimethyldeca-3,5-dienyl]phenyl]methyl-ethylamino]-3-fluorocyclohepta-1,4,6-triene-1-carboxylate |
| SMILES | CCCC/C(C)=C/C=C(\C)CCc1ccc(CN(CC)C2=CC(C(=O)OC)=CC(F)C=C2)cc1 |
| InChI | InChI=1S/C30H40FNO2/c1-6-8-9-23(3)10-11-24(4)12-13-25-14-16-26(17-15-25)22-32(7-2)29-19-18-28(31)20-27(21-29)30(33)34-5/h10-11,14-21,28H,6-9,12-13,22H2,1-5H3/b23-10+,24-11+ |
| InChIKey | FOJNDFPDGBVFIK-HIWNQQMRSA-N |
| XLogP | 7.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.65 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|