C20H28FNO2 — CID 66993861
ethyl 3-[4-[dimethylamino-(4-fluorophenyl)methyl]cyclohexyl]prop-2-enoate (PubChem CID 66993861) has the molecular formula C20H28FNO2 and a molecular weight of 333.45 g/mol. Its IUPAC name is ethyl 3-[4-[dimethylamino-(4-fluorophenyl)methyl]cyclohexyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-[dimethylamino-(4-fluorophenyl)methyl]cyclohexyl]prop-2-enoate |
|---|---|
| PubChem CID | 66993861 |
| Molecular Formula | C20H28FNO2 |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | ethyl 3-[4-[dimethylamino-(4-fluorophenyl)methyl]cyclohexyl]prop-2-enoate |
| SMILES | CCOC(=O)C=CC1CCC(C(c2ccc(F)cc2)N(C)C)CC1 |
| InChI | InChI=1S/C20H28FNO2/c1-4-24-19(23)14-7-15-5-8-16(9-6-15)20(22(2)3)17-10-12-18(21)13-11-17/h7,10-16,20H,4-6,8-9H2,1-3H3 |
| InChIKey | PGSBBTGAJICPSF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|