About ethyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate
ethyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate (PubChem CID 139234922) has the molecular formula C19H17F2NO3
and a molecular weight of 345.35 g/mol. Its IUPAC name is ethyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate |
| PubChem CID | 139234922 |
| Molecular Formula | C19H17F2NO3 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | ethyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](c2c(F)cccc2F)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C19H17F2NO3/c1-2-24-19(23)17-11-16(18-14(20)9-6-10-15(18)21)22(25-17)12-13-7-4-3-5-8-13/h3-11,16H,2,12H2,1H3/t16-/m0/s1 |
| InChIKey | PDGYDPVEHCZIGD-INIZCTEOSA-N |
| XLogP | 3.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate?
The IUPAC name of ethyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate (CID 139234922) is ethyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate.
What is the SMILES notation for ethyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate?
The canonical SMILES for ethyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate is CCOC(=O)C1=C[C@@H](c2c(F)cccc2F)N(Cc2ccccc2)O1.
What is the InChIKey of ethyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate?
The InChIKey is PDGYDPVEHCZIGD-INIZCTEOSA-N. The full InChI is InChI=1S/C19H17F2NO3/c1-2-24-19(23)17-11-16(18-14(20)9-6-10-15(18)21)22(25-17)12-13-7-4-3-5-8-13/h3-11,16H,2,12H2,1H3/t16-/m0/s1.
What are the key properties of ethyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate?
ethyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate has a molecular weight of 345.35 g/mol, XLogP of 3.90, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 139234922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).