C20H29F3N10O — CID 143119011
5-N-(2-ethoxyethyl)-2-piperazin-1-yl-4-N-pyrimidin-4-yl-6-[2-(2,2,2-trifluoroethylamino)ethanimidoyl]pyrimidine-4,5-diamine (PubChem CID 143119011) has the molecular formula C20H29F3N10O and a molecular weight of 482.52 g/mol. Its IUPAC name is 5-N-(2-ethoxyethyl)-2-piperazin-1-yl-4-N-pyrimidin-4-yl-6-[2-(2,2,2-trifluoroethylamino)ethanimidoyl]pyrimidine-4,5-diamine.
| Compound Name | 5-N-(2-ethoxyethyl)-2-piperazin-1-yl-4-N-pyrimidin-4-yl-6-[2-(2,2,2-trifluoroethylamino)ethanimidoyl]pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 143119011 |
| Molecular Formula | C20H29F3N10O |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 5-N-(2-ethoxyethyl)-2-piperazin-1-yl-4-N-pyrimidin-4-yl-6-[2-(2,2,2-trifluoroethylamino)ethanimidoyl]pyrimidine-4,5-diamine |
| SMILES | [H]/N=C(\CNCC(F)(F)F)c1nc(N2CCNCC2)nc(Nc2ccncn2)c1NCCOCC |
| InChI | InChI=1S/C20H29F3N10O/c1-2-34-10-7-28-17-16(14(24)11-27-12-20(21,22)23)31-19(33-8-5-25-6-9-33)32-18(17)30-15-3-4-26-13-29-15/h3-4,13,24-25,27-28H,2,5-12H2,1H3,(H,26,29,30,31,32)/b24-14+ |
| InChIKey | POBKLZLXAJAWDF-ZVHZXABRSA-N |
| XLogP | 1.39 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|