C21H31F3N10O — CID 143119018
6-[2-[ethyl(methyl)amino]ethanimidoyl]-2-piperazin-1-yl-4-N-pyrimidin-4-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,5-diamine (PubChem CID 143119018) has the molecular formula C21H31F3N10O and a molecular weight of 496.54 g/mol. Its IUPAC name is 6-[2-[ethyl(methyl)amino]ethanimidoyl]-2-piperazin-1-yl-4-N-pyrimidin-4-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,5-diamine.
| Compound Name | 6-[2-[ethyl(methyl)amino]ethanimidoyl]-2-piperazin-1-yl-4-N-pyrimidin-4-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 143119018 |
| Molecular Formula | C21H31F3N10O |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 6-[2-[ethyl(methyl)amino]ethanimidoyl]-2-piperazin-1-yl-4-N-pyrimidin-4-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,5-diamine |
| SMILES | [H]/N=C(\CN(C)CC)c1nc(N2CCNCC2)nc(Nc2ccncn2)c1NCCOCC(F)(F)F |
| InChI | InChI=1S/C21H31F3N10O/c1-3-33(2)12-15(25)17-18(28-8-11-35-13-21(22,23)24)19(30-16-4-5-27-14-29-16)32-20(31-17)34-9-6-26-7-10-34/h4-5,14,25-26,28H,3,6-13H2,1-2H3,(H,27,29,30,31,32)/b25-15+ |
| InChIKey | NQFQETQOQFIJQE-MFKUBSTISA-N |
| XLogP | 1.73 |
| TPSA | 127.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|