About 1-methyl-4-[(4Z,6Z)-6-methyl-2-(4-methylphenyl)octa-4,6-dien-2-yl]benzene
1-methyl-4-[(4Z,6Z)-6-methyl-2-(4-methylphenyl)octa-4,6-dien-2-yl]benzene (PubChem CID 143119388) has the molecular formula C23H28
and a molecular weight of 304.48 g/mol. Its IUPAC name is 1-methyl-4-[(4Z,6Z)-6-methyl-2-(4-methylphenyl)octa-4,6-dien-2-yl]benzene.
Molecular Properties
| Compound Name | 1-methyl-4-[(4Z,6Z)-6-methyl-2-(4-methylphenyl)octa-4,6-dien-2-yl]benzene |
| PubChem CID | 143119388 |
| Molecular Formula | C23H28 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-methyl-4-[(4Z,6Z)-6-methyl-2-(4-methylphenyl)octa-4,6-dien-2-yl]benzene |
| SMILES | C/C=C(C)\C=C/CC(C)(c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H28/c1-6-18(2)8-7-17-23(5,21-13-9-19(3)10-14-21)22-15-11-20(4)12-16-22/h6-16H,17H2,1-5H3/b8-7-,18-6- |
| InChIKey | GKBHMCRSAUUQJS-ODECTHOPSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-[(4Z,6Z)-6-methyl-2-(4-methylphenyl)octa-4,6-dien-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[(4Z,6Z)-6-methyl-2-(4-methylphenyl)octa-4,6-dien-2-yl]benzene?
The IUPAC name of 1-methyl-4-[(4Z,6Z)-6-methyl-2-(4-methylphenyl)octa-4,6-dien-2-yl]benzene (CID 143119388) is 1-methyl-4-[(4Z,6Z)-6-methyl-2-(4-methylphenyl)octa-4,6-dien-2-yl]benzene.
What is the SMILES notation for 1-methyl-4-[(4Z,6Z)-6-methyl-2-(4-methylphenyl)octa-4,6-dien-2-yl]benzene?
The canonical SMILES for 1-methyl-4-[(4Z,6Z)-6-methyl-2-(4-methylphenyl)octa-4,6-dien-2-yl]benzene is C/C=C(C)\C=C/CC(C)(c1ccc(C)cc1)c1ccc(C)cc1.
What is the InChIKey of 1-methyl-4-[(4Z,6Z)-6-methyl-2-(4-methylphenyl)octa-4,6-dien-2-yl]benzene?
The InChIKey is GKBHMCRSAUUQJS-ODECTHOPSA-N. The full InChI is InChI=1S/C23H28/c1-6-18(2)8-7-17-23(5,21-13-9-19(3)10-14-21)22-15-11-20(4)12-16-22/h6-16H,17H2,1-5H3/b8-7-,18-6-.
What are the key properties of 1-methyl-4-[(4Z,6Z)-6-methyl-2-(4-methylphenyl)octa-4,6-dien-2-yl]benzene?
1-methyl-4-[(4Z,6Z)-6-methyl-2-(4-methylphenyl)octa-4,6-dien-2-yl]benzene has a molecular weight of 304.48 g/mol, XLogP of 6.52, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[(4Z,6Z)-6-methyl-2-(4-methylphenyl)octa-4,6-dien-2-yl]benzene is sourced from PubChem (CID 143119388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).