C26H24N5O2+ — CID 143120577
[3-[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]-1-(hydroxymethyl)cyclobutyl]oxidanium (PubChem CID 143120577) has the molecular formula C26H24N5O2+ and a molecular weight of 438.51 g/mol. Its IUPAC name is [3-[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]-1-(hydroxymethyl)cyclobutyl]oxidanium.
| Compound Name | [3-[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]-1-(hydroxymethyl)cyclobutyl]oxidanium |
|---|---|
| PubChem CID | 143120577 |
| Molecular Formula | C26H24N5O2+ |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | [3-[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]-1-(hydroxymethyl)cyclobutyl]oxidanium |
| SMILES | Nc1nccn2c(C3CC([OH2+])(CO)C3)nc(-c3ccc4ccc(-c5ccccc5)nc4c3)c12 |
| InChI | InChI=1S/C26H23N5O2/c27-24-23-22(30-25(31(23)11-10-28-24)19-13-26(33,14-19)15-32)18-7-6-17-8-9-20(29-21(17)12-18)16-4-2-1-3-5-16/h1-12,19,32-33H,13-15H2,(H2,27,28)/p+1 |
| InChIKey | HNTFTTBRCDCKCO-UHFFFAOYSA-O |
| XLogP | 3.53 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|