C29H29N7S — CID 163615088
1-(2-phenylquinolin-7-yl)-3-[3-(4-sulfanylpiperazin-1-yl)cyclobutyl]imidazo[1,5-a]pyrazin-8-amine (PubChem CID 163615088) has the molecular formula C29H29N7S and a molecular weight of 507.67 g/mol. Its IUPAC name is 1-(2-phenylquinolin-7-yl)-3-[3-(4-sulfanylpiperazin-1-yl)cyclobutyl]imidazo[1,5-a]pyrazin-8-amine.
| Compound Name | 1-(2-phenylquinolin-7-yl)-3-[3-(4-sulfanylpiperazin-1-yl)cyclobutyl]imidazo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 163615088 |
| Molecular Formula | C29H29N7S |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 1-(2-phenylquinolin-7-yl)-3-[3-(4-sulfanylpiperazin-1-yl)cyclobutyl]imidazo[1,5-a]pyrazin-8-amine |
| SMILES | Nc1nccn2c(C3CC(N4CCN(S)CC4)C3)nc(-c3ccc4ccc(-c5ccccc5)nc4c3)c12 |
| InChI | InChI=1S/C29H29N7S/c30-28-27-26(21-7-6-20-8-9-24(32-25(20)18-21)19-4-2-1-3-5-19)33-29(36(27)11-10-31-28)22-16-23(17-22)34-12-14-35(37)15-13-34/h1-11,18,22-23,37H,12-17H2,(H2,30,31) |
| InChIKey | HJHIMZGGFCQZRS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 75.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|