C30H37FN2O7 — CID 143120871
ethane;6-[4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxyquinolin-7-yl]oxy-3,5-dihydroxyhexanoic acid;prop-1-ene (PubChem CID 143120871) has the molecular formula C30H37FN2O7 and a molecular weight of 556.63 g/mol. Its IUPAC name is ethane;6-[4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxyquinolin-7-yl]oxy-3,5-dihydroxyhexanoic acid;prop-1-ene.
| Compound Name | ethane;6-[4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxyquinolin-7-yl]oxy-3,5-dihydroxyhexanoic acid;prop-1-ene |
|---|---|
| PubChem CID | 143120871 |
| Molecular Formula | C30H37FN2O7 |
| Molecular Weight | 556.63 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | ethane;6-[4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxyquinolin-7-yl]oxy-3,5-dihydroxyhexanoic acid;prop-1-ene |
| SMILES | C=CC.CC.COc1cc2c(Oc3ccc4[nH]c(C)cc4c3F)ccnc2cc1OCC(O)CC(O)CC(=O)O |
| InChI | InChI=1S/C25H25FN2O7.C3H6.C2H6/c1-13-7-17-18(28-13)3-4-21(25(17)26)35-20-5-6-27-19-11-23(22(33-2)10-16(19)20)34-12-15(30)8-14(29)9-24(31)32;1-3-2;1-2/h3-7,10-11,14-15,28-30H,8-9,12H2,1-2H3,(H,31,32);3H,1H2,2H3;1-2H3 |
| InChIKey | UQHLEFUJBJXIMK-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 134.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|