C21H17F4N3O3 — CID 175092865
[4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxy-3-(trifluoromethyl)quinolin-7-yl]oxymethanamine (PubChem CID 175092865) has the molecular formula C21H17F4N3O3 and a molecular weight of 435.38 g/mol. Its IUPAC name is [4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxy-3-(trifluoromethyl)quinolin-7-yl]oxymethanamine.
| Compound Name | [4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxy-3-(trifluoromethyl)quinolin-7-yl]oxymethanamine |
|---|---|
| PubChem CID | 175092865 |
| Molecular Formula | C21H17F4N3O3 |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | [4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxy-3-(trifluoromethyl)quinolin-7-yl]oxymethanamine |
| SMILES | COc1cc2c(Oc3ccc4[nH]c(C)cc4c3F)c(C(F)(F)F)cnc2cc1OCN |
| InChI | InChI=1S/C21H17F4N3O3/c1-10-5-11-14(28-10)3-4-16(19(11)22)31-20-12-6-17(29-2)18(30-9-26)7-15(12)27-8-13(20)21(23,24)25/h3-8,28H,9,26H2,1-2H3 |
| InChIKey | GBPBLZAKFBXOCD-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|