C20H18FIN4O3 — CID 163654120
N-[4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxyquinazolin-7-yl]oxy-N-(methylidene-λ3-iodanyl)methanamine (PubChem CID 163654120) has the molecular formula C20H18FIN4O3 and a molecular weight of 508.29 g/mol. Its IUPAC name is N-[4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxyquinazolin-7-yl]oxy-N-(methylidene-λ3-iodanyl)methanamine.
| Compound Name | N-[4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxyquinazolin-7-yl]oxy-N-(methylidene-λ3-iodanyl)methanamine |
|---|---|
| PubChem CID | 163654120 |
| Molecular Formula | C20H18FIN4O3 |
| Molecular Weight | 508.29 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | N-[4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxyquinazolin-7-yl]oxy-N-(methylidene-λ3-iodanyl)methanamine |
| SMILES | C=IN(C)Oc1cc2ncnc(Oc3ccc4[nH]c(C)cc4c3F)c2cc1OC |
| InChI | InChI=1S/C20H18FIN4O3/c1-11-7-12-14(25-11)5-6-16(19(12)21)28-20-13-8-17(27-4)18(29-26(3)22-2)9-15(13)23-10-24-20/h5-10,25H,2H2,1,3-4H3 |
| InChIKey | IOSFFADSNXJZRS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.29 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|