C27H31FN3O2P — CID 90917695
[7-(5-cyclopentylpentoxy)-4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]quinazolin-6-yl]phosphane (PubChem CID 90917695) has the molecular formula C27H31FN3O2P and a molecular weight of 479.54 g/mol. Its IUPAC name is [7-(5-cyclopentylpentoxy)-4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]quinazolin-6-yl]phosphane.
| Compound Name | [7-(5-cyclopentylpentoxy)-4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]quinazolin-6-yl]phosphane |
|---|---|
| PubChem CID | 90917695 |
| Molecular Formula | C27H31FN3O2P |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | [7-(5-cyclopentylpentoxy)-4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]quinazolin-6-yl]phosphane |
| SMILES | Cc1cc2c(F)c(Oc3ncnc4cc(OCCCCCC5CCCC5)c(P)cc34)ccc2[nH]1 |
| InChI | InChI=1S/C27H31FN3O2P/c1-17-13-19-21(31-17)10-11-23(26(19)28)33-27-20-14-25(34)24(15-22(20)29-16-30-27)32-12-6-2-3-7-18-8-4-5-9-18/h10-11,13-16,18,31H,2-9,12,34H2,1H3 |
| InChIKey | AMWZEUJNFRRJCL-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|