C31H35N5O3 — CID 143121631
[4-methyl-3-[5-methyl-3-[4-(2-pyrrolidin-1-ylethoxy)anilino]-1,2,4-benzotriazin-7-yl]phenyl] 2-methylpropanoate (PubChem CID 143121631) has the molecular formula C31H35N5O3 and a molecular weight of 525.65 g/mol. Its IUPAC name is [4-methyl-3-[5-methyl-3-[4-(2-pyrrolidin-1-ylethoxy)anilino]-1,2,4-benzotriazin-7-yl]phenyl] 2-methylpropanoate.
| Compound Name | [4-methyl-3-[5-methyl-3-[4-(2-pyrrolidin-1-ylethoxy)anilino]-1,2,4-benzotriazin-7-yl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 143121631 |
| Molecular Formula | C31H35N5O3 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | [4-methyl-3-[5-methyl-3-[4-(2-pyrrolidin-1-ylethoxy)anilino]-1,2,4-benzotriazin-7-yl]phenyl] 2-methylpropanoate |
| SMILES | Cc1ccc(OC(=O)C(C)C)cc1-c1cc(C)c2nc(Nc3ccc(OCCN4CCCC4)cc3)nnc2c1 |
| InChI | InChI=1S/C31H35N5O3/c1-20(2)30(37)39-26-10-7-21(3)27(19-26)23-17-22(4)29-28(18-23)34-35-31(33-29)32-24-8-11-25(12-9-24)38-16-15-36-13-5-6-14-36/h7-12,17-20H,5-6,13-16H2,1-4H3,(H,32,33,35) |
| InChIKey | QSDQAKNSLHHYFT-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|