C33H32N6O3 — CID 149490706
[4-methyl-3-[5-methyl-3-[4-(2-pyrrolidin-1-ylethoxy)anilino]-1,2,4-benzotriazin-7-yl]phenyl] pyridine-3-carboxylate (PubChem CID 149490706) has the molecular formula C33H32N6O3 and a molecular weight of 560.66 g/mol. Its IUPAC name is [4-methyl-3-[5-methyl-3-[4-(2-pyrrolidin-1-ylethoxy)anilino]-1,2,4-benzotriazin-7-yl]phenyl] pyridine-3-carboxylate.
| Compound Name | [4-methyl-3-[5-methyl-3-[4-(2-pyrrolidin-1-ylethoxy)anilino]-1,2,4-benzotriazin-7-yl]phenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 149490706 |
| Molecular Formula | C33H32N6O3 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | [4-methyl-3-[5-methyl-3-[4-(2-pyrrolidin-1-ylethoxy)anilino]-1,2,4-benzotriazin-7-yl]phenyl] pyridine-3-carboxylate |
| SMILES | Cc1ccc(OC(=O)c2cccnc2)cc1-c1cc(C)c2nc(Nc3ccc(OCCN4CCCC4)cc3)nnc2c1 |
| InChI | InChI=1S/C33H32N6O3/c1-22-7-10-28(42-32(40)24-6-5-13-34-21-24)20-29(22)25-18-23(2)31-30(19-25)37-38-33(36-31)35-26-8-11-27(12-9-26)41-17-16-39-14-3-4-15-39/h5-13,18-21H,3-4,14-17H2,1-2H3,(H,35,36,38) |
| InChIKey | ZFAMKEGHOXEYMB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|