C20H28BrF3N2O — CID 143122230
(3R)-3-[[4-amino-3-bromo-5-(trifluoromethyl)phenyl]methyl]-6-(4-methylpiperidin-1-yl)hexan-2-one (PubChem CID 143122230) has the molecular formula C20H28BrF3N2O and a molecular weight of 449.36 g/mol. Its IUPAC name is (3R)-3-[[4-amino-3-bromo-5-(trifluoromethyl)phenyl]methyl]-6-(4-methylpiperidin-1-yl)hexan-2-one.
| Compound Name | (3R)-3-[[4-amino-3-bromo-5-(trifluoromethyl)phenyl]methyl]-6-(4-methylpiperidin-1-yl)hexan-2-one |
|---|---|
| PubChem CID | 143122230 |
| Molecular Formula | C20H28BrF3N2O |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | (3R)-3-[[4-amino-3-bromo-5-(trifluoromethyl)phenyl]methyl]-6-(4-methylpiperidin-1-yl)hexan-2-one |
| SMILES | CC(=O)C(CCCN1CCC(C)CC1)Cc1cc(Br)c(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H28BrF3N2O/c1-13-5-8-26(9-6-13)7-3-4-16(14(2)27)10-15-11-17(20(22,23)24)19(25)18(21)12-15/h11-13,16H,3-10,25H2,1-2H3 |
| InChIKey | KINLLSYXCIPIMI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|