C13H17BrClF3N2O — CID 86736063
1-[4-amino-3-bromo-5-(trifluoromethyl)phenyl]-2-(tert-butylamino)ethanone;hydrochloride (PubChem CID 86736063) has the molecular formula C13H17BrClF3N2O and a molecular weight of 389.64 g/mol. Its IUPAC name is 1-[4-amino-3-bromo-5-(trifluoromethyl)phenyl]-2-(tert-butylamino)ethanone;hydrochloride.
| Compound Name | 1-[4-amino-3-bromo-5-(trifluoromethyl)phenyl]-2-(tert-butylamino)ethanone;hydrochloride |
|---|---|
| PubChem CID | 86736063 |
| Molecular Formula | C13H17BrClF3N2O |
| Molecular Weight | 389.64 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 1-[4-amino-3-bromo-5-(trifluoromethyl)phenyl]-2-(tert-butylamino)ethanone;hydrochloride |
| SMILES | CC(C)(C)NCC(=O)c1cc(Br)c(N)c(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C13H16BrF3N2O.ClH/c1-12(2,3)19-6-10(20)7-4-8(13(15,16)17)11(18)9(14)5-7;/h4-5,19H,6,18H2,1-3H3;1H |
| InChIKey | AIJGYQGINIJOAO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.64 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|