C25H31Cl2N3O — CID 143123914
2-(2-chlorophenyl)-1-(4-chlorophenyl)imidazole;N-(3-ethylhexan-2-yl)acetamide (PubChem CID 143123914) has the molecular formula C25H31Cl2N3O and a molecular weight of 460.45 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-(4-chlorophenyl)imidazole;N-(3-ethylhexan-2-yl)acetamide.
| Compound Name | 2-(2-chlorophenyl)-1-(4-chlorophenyl)imidazole;N-(3-ethylhexan-2-yl)acetamide |
|---|---|
| PubChem CID | 143123914 |
| Molecular Formula | C25H31Cl2N3O |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 2-(2-chlorophenyl)-1-(4-chlorophenyl)imidazole;N-(3-ethylhexan-2-yl)acetamide |
| SMILES | CCCC(CC)C(C)NC(C)=O.Clc1ccc(-n2ccnc2-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C15H10Cl2N2.C10H21NO/c16-11-5-7-12(8-6-11)19-10-9-18-15(19)13-3-1-2-4-14(13)17;1-5-7-10(6-2)8(3)11-9(4)12/h1-10H;8,10H,5-7H2,1-4H3,(H,11,12) |
| InChIKey | HIGABASPVVGVDK-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |