C24H28Cl2N4O — CID 142992071
N-butyl-2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-[(propan-2-ylamino)methyl]imidazole-4-carboxamide (PubChem CID 142992071) has the molecular formula C24H28Cl2N4O and a molecular weight of 459.42 g/mol. Its IUPAC name is N-butyl-2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-[(propan-2-ylamino)methyl]imidazole-4-carboxamide.
| Compound Name | N-butyl-2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-[(propan-2-ylamino)methyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 142992071 |
| Molecular Formula | C24H28Cl2N4O |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N-butyl-2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-[(propan-2-ylamino)methyl]imidazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1nc(-c2ccccc2Cl)n(-c2ccc(Cl)cc2)c1CNC(C)C |
| InChI | InChI=1S/C24H28Cl2N4O/c1-4-5-14-27-24(31)22-21(15-28-16(2)3)30(18-12-10-17(25)11-13-18)23(29-22)19-8-6-7-9-20(19)26/h6-13,16,28H,4-5,14-15H2,1-3H3,(H,27,31) |
| InChIKey | GISXLQRMMYYQLF-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|