C23H26Cl2N4O2 — CID 172783819
2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-ethylimidazole-4-carboxylic acid;piperidin-1-amine (PubChem CID 172783819) has the molecular formula C23H26Cl2N4O2 and a molecular weight of 461.39 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-ethylimidazole-4-carboxylic acid;piperidin-1-amine.
| Compound Name | 2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-ethylimidazole-4-carboxylic acid;piperidin-1-amine |
|---|---|
| PubChem CID | 172783819 |
| Molecular Formula | C23H26Cl2N4O2 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-ethylimidazole-4-carboxylic acid;piperidin-1-amine |
| SMILES | CCc1c(C(=O)O)nc(-c2ccccc2Cl)n1-c1ccc(Cl)cc1.NN1CCCCC1 |
| InChI | InChI=1S/C18H14Cl2N2O2.C5H12N2/c1-2-15-16(18(23)24)21-17(13-5-3-4-6-14(13)20)22(15)12-9-7-11(19)8-10-12;6-7-4-2-1-3-5-7/h3-10H,2H2,1H3,(H,23,24);1-6H2 |
| InChIKey | OPPOVSMWZDJTIL-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|