C38H41Cl2N5O — CID 25168166
2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-ethyl-N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]imidazole-4-carboxamide (PubChem CID 25168166) has the molecular formula C38H41Cl2N5O and a molecular weight of 654.69 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-ethyl-N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]imidazole-4-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-ethyl-N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 25168166 |
| Molecular Formula | C38H41Cl2N5O |
| Molecular Weight | 654.69 g/mol |
| Exact Mass | 653.27 |
| IUPAC Name | 2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-ethyl-N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]imidazole-4-carboxamide |
| SMILES | CCc1c(C(=O)NCCCCCCCNc2c3c(nc4ccccc24)CCCC3)nc(-c2ccccc2Cl)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C38H41Cl2N5O/c1-2-34-36(44-37(28-14-6-9-17-31(28)40)45(34)27-22-20-26(39)21-23-27)38(46)42-25-13-5-3-4-12-24-41-35-29-15-7-10-18-32(29)43-33-19-11-8-16-30(33)35/h6-7,9-10,14-15,17-18,20-23H,2-5,8,11-13,16,19,24-25H2,1H3,(H,41,43)(H,42,46) |
| InChIKey | IBNHPFJFQUFNTI-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.69 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|