C19H16Cl2N4O2 — CID 91173919
ethyl 2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-(diazenylmethyl)imidazole-4-carboxylate (PubChem CID 91173919) has the molecular formula C19H16Cl2N4O2 and a molecular weight of 403.27 g/mol. Its IUPAC name is ethyl 2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-(diazenylmethyl)imidazole-4-carboxylate.
| Compound Name | ethyl 2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-(diazenylmethyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 91173919 |
| Molecular Formula | C19H16Cl2N4O2 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | ethyl 2-(2-chlorophenyl)-1-(4-chlorophenyl)-5-(diazenylmethyl)imidazole-4-carboxylate |
| SMILES | [H]/N=N/Cc1c(C(=O)OCC)nc(-c2ccccc2Cl)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16Cl2N4O2/c1-2-27-19(26)17-16(11-23-22)25(13-9-7-12(20)8-10-13)18(24-17)14-5-3-4-6-15(14)21/h3-10,22H,2,11H2,1H3/b23-22+ |
| InChIKey | MCIHOUHHDDXRHI-GHVJWSGMSA-N |
| XLogP | 5.55 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|