C24H25F4N3O2 — CID 143125629
(E)-3-[2-amino-4-methyl-5-(trifluoromethoxy)phenyl]-1-[3-[(4-fluorophenyl)methyl]-3,8-diazabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one (PubChem CID 143125629) has the molecular formula C24H25F4N3O2 and a molecular weight of 463.48 g/mol. Its IUPAC name is (E)-3-[2-amino-4-methyl-5-(trifluoromethoxy)phenyl]-1-[3-[(4-fluorophenyl)methyl]-3,8-diazabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[2-amino-4-methyl-5-(trifluoromethoxy)phenyl]-1-[3-[(4-fluorophenyl)methyl]-3,8-diazabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 143125629 |
| Molecular Formula | C24H25F4N3O2 |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | (E)-3-[2-amino-4-methyl-5-(trifluoromethoxy)phenyl]-1-[3-[(4-fluorophenyl)methyl]-3,8-diazabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one |
| SMILES | Cc1cc(N)c(/C=C/C(=O)N2C3CCC2CN(Cc2ccc(F)cc2)C3)cc1OC(F)(F)F |
| InChI | InChI=1S/C24H25F4N3O2/c1-15-10-21(29)17(11-22(15)33-24(26,27)28)4-9-23(32)31-19-7-8-20(31)14-30(13-19)12-16-2-5-18(25)6-3-16/h2-6,9-11,19-20H,7-8,12-14,29H2,1H3/b9-4+ |
| InChIKey | LPBMVJDNAVXNQP-RUDMXATFSA-N |
| XLogP | 4.50 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|