C24H28FN3O2 — CID 143125624
(E)-3-(2-amino-5-methoxy-4-methylphenyl)-1-[3-[(4-fluorophenyl)methyl]-3,8-diazabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one (PubChem CID 143125624) has the molecular formula C24H28FN3O2 and a molecular weight of 409.51 g/mol. Its IUPAC name is (E)-3-(2-amino-5-methoxy-4-methylphenyl)-1-[3-[(4-fluorophenyl)methyl]-3,8-diazabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-amino-5-methoxy-4-methylphenyl)-1-[3-[(4-fluorophenyl)methyl]-3,8-diazabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 143125624 |
| Molecular Formula | C24H28FN3O2 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | (E)-3-(2-amino-5-methoxy-4-methylphenyl)-1-[3-[(4-fluorophenyl)methyl]-3,8-diazabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2C3CCC2CN(Cc2ccc(F)cc2)C3)c(N)cc1C |
| InChI | InChI=1S/C24H28FN3O2/c1-16-11-22(26)18(12-23(16)30-2)5-10-24(29)28-20-8-9-21(28)15-27(14-20)13-17-3-6-19(25)7-4-17/h3-7,10-12,20-21H,8-9,13-15,26H2,1-2H3/b10-5+ |
| InChIKey | UUQLXASYCVXIGT-BJMVGYQFSA-N |
| XLogP | 3.61 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|