C23H25ClFN3O2 — CID 58946771
(E)-3-(2-amino-4-chloro-5-methoxyphenyl)-1-[(1S,5R)-3-(4-fluoroanilino)-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one (PubChem CID 58946771) has the molecular formula C23H25ClFN3O2 and a molecular weight of 429.92 g/mol. Its IUPAC name is (E)-3-(2-amino-4-chloro-5-methoxyphenyl)-1-[(1S,5R)-3-(4-fluoroanilino)-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-amino-4-chloro-5-methoxyphenyl)-1-[(1S,5R)-3-(4-fluoroanilino)-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 58946771 |
| Molecular Formula | C23H25ClFN3O2 |
| Molecular Weight | 429.92 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (E)-3-(2-amino-4-chloro-5-methoxyphenyl)-1-[(1S,5R)-3-(4-fluoroanilino)-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2[C@@H]3CC[C@H]2CC(Nc2ccc(F)cc2)C3)c(N)cc1Cl |
| InChI | InChI=1S/C23H25ClFN3O2/c1-30-22-10-14(21(26)13-20(22)24)2-9-23(29)28-18-7-8-19(28)12-17(11-18)27-16-5-3-15(25)4-6-16/h2-6,9-10,13,17-19,27H,7-8,11-12,26H2,1H3/b9-2+/t17?,18-,19+ |
| InChIKey | QRVJSVWPRGTCOU-TWSPHTTESA-N |
| XLogP | 4.72 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.92 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|