C20H26ClN — CID 143126857
4-[1-(5-chloronaphthalen-1-yl)ethyl]azonane (PubChem CID 143126857) has the molecular formula C20H26ClN and a molecular weight of 315.89 g/mol. Its IUPAC name is 4-[1-(5-chloronaphthalen-1-yl)ethyl]azonane.
| Compound Name | 4-[1-(5-chloronaphthalen-1-yl)ethyl]azonane |
|---|---|
| PubChem CID | 143126857 |
| Molecular Formula | C20H26ClN |
| Molecular Weight | 315.89 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 4-[1-(5-chloronaphthalen-1-yl)ethyl]azonane |
| SMILES | CC(c1cccc2c(Cl)cccc12)C1CCCCCNCC1 |
| InChI | InChI=1S/C20H26ClN/c1-15(16-7-3-2-4-13-22-14-12-16)17-8-5-10-19-18(17)9-6-11-20(19)21/h5-6,8-11,15-16,22H,2-4,7,12-14H2,1H3 |
| InChIKey | MMQDERFRRRYSST-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.89 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |