C28H41ClN4O4S — CID 143127654
tert-butyl N-[(2R)-2-[5-[(2E,4E)-6-chloro-2-[methyl(methylsulfinyl)amino]hepta-2,4-dien-4-yl]-1,3,4-oxadiazol-2-yl]-1-phenylpropan-2-yl]carbamate;prop-1-ene (PubChem CID 143127654) has the molecular formula C28H41ClN4O4S and a molecular weight of 565.18 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-[5-[(2E,4E)-6-chloro-2-[methyl(methylsulfinyl)amino]hepta-2,4-dien-4-yl]-1,3,4-oxadiazol-2-yl]-1-phenylpropan-2-yl]carbamate;prop-1-ene.
| Compound Name | tert-butyl N-[(2R)-2-[5-[(2E,4E)-6-chloro-2-[methyl(methylsulfinyl)amino]hepta-2,4-dien-4-yl]-1,3,4-oxadiazol-2-yl]-1-phenylpropan-2-yl]carbamate;prop-1-ene |
|---|---|
| PubChem CID | 143127654 |
| Molecular Formula | C28H41ClN4O4S |
| Molecular Weight | 565.18 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | tert-butyl N-[(2R)-2-[5-[(2E,4E)-6-chloro-2-[methyl(methylsulfinyl)amino]hepta-2,4-dien-4-yl]-1,3,4-oxadiazol-2-yl]-1-phenylpropan-2-yl]carbamate;prop-1-ene |
| SMILES | C/C(=C\C(=C/C(C)Cl)c1nnc([C@@](C)(Cc2ccccc2)NC(=O)OC(C)(C)C)o1)N(C)S(C)=O.C=CC |
| InChI | InChI=1S/C25H35ClN4O4S.C3H6/c1-17(26)14-20(15-18(2)30(7)35(8)32)21-28-29-22(33-21)25(6,16-19-12-10-9-11-13-19)27-23(31)34-24(3,4)5;1-3-2/h9-15,17H,16H2,1-8H3,(H,27,31);3H,1H2,2H3/b18-15+,20-14+;/t17?,25-,35?;/m1./s1 |
| InChIKey | RLMLXIYCZZGCIH-MEPNFOMKSA-N |
| XLogP | 6.38 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.18 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|