C14H17ClN2O2 — CID 68787554
tert-butyl N-(1-chloro-1-cyano-2-phenylethyl)carbamate (PubChem CID 68787554) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is tert-butyl N-(1-chloro-1-cyano-2-phenylethyl)carbamate.
| Compound Name | tert-butyl N-(1-chloro-1-cyano-2-phenylethyl)carbamate |
|---|---|
| PubChem CID | 68787554 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | tert-butyl N-(1-chloro-1-cyano-2-phenylethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cl)(C#N)Cc1ccccc1 |
| InChI | InChI=1S/C14H17ClN2O2/c1-13(2,3)19-12(18)17-14(15,10-16)9-11-7-5-4-6-8-11/h4-8H,9H2,1-3H3,(H,17,18) |
| InChIKey | VBIPALSGPHLVBP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|