C16H23NO3 — CID 87172993
tert-butyl N-[2-(oxiran-2-yl)-1-phenylpropan-2-yl]carbamate (PubChem CID 87172993) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is tert-butyl N-[2-(oxiran-2-yl)-1-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-(oxiran-2-yl)-1-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 87172993 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | tert-butyl N-[2-(oxiran-2-yl)-1-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C)(Cc1ccccc1)C1CO1 |
| InChI | InChI=1S/C16H23NO3/c1-15(2,3)20-14(18)17-16(4,13-11-19-13)10-12-8-6-5-7-9-12/h5-9,13H,10-11H2,1-4H3,(H,17,18) |
| InChIKey | VWCBTHQMPMOTJB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|