C15H16N4O4S — CID 143129105
2-(carbamoylamino)-5-[[2-(3-methylphenoxy)acetyl]amino]thiophene-3-carboxamide (PubChem CID 143129105) has the molecular formula C15H16N4O4S and a molecular weight of 348.38 g/mol. Its IUPAC name is 2-(carbamoylamino)-5-[[2-(3-methylphenoxy)acetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-5-[[2-(3-methylphenoxy)acetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 143129105 |
| Molecular Formula | C15H16N4O4S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-(carbamoylamino)-5-[[2-(3-methylphenoxy)acetyl]amino]thiophene-3-carboxamide |
| SMILES | Cc1cccc(OCC(=O)Nc2cc(C(N)=O)c(NC(N)=O)s2)c1 |
| InChI | InChI=1S/C15H16N4O4S/c1-8-3-2-4-9(5-8)23-7-11(20)18-12-6-10(13(16)21)14(24-12)19-15(17)22/h2-6H,7H2,1H3,(H2,16,21)(H,18,20)(H3,17,19,22) |
| InChIKey | GKJNMCRZRFLHQT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |