C25H39N3O4 — CID 143130888
N-cyclohexyl-10-(3-ethoxypropyl)-4,11-dimethyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide;ethane (PubChem CID 143130888) has the molecular formula C25H39N3O4 and a molecular weight of 445.60 g/mol. Its IUPAC name is N-cyclohexyl-10-(3-ethoxypropyl)-4,11-dimethyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide;ethane.
| Compound Name | N-cyclohexyl-10-(3-ethoxypropyl)-4,11-dimethyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide;ethane |
|---|---|
| PubChem CID | 143130888 |
| Molecular Formula | C25H39N3O4 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.29 |
| IUPAC Name | N-cyclohexyl-10-(3-ethoxypropyl)-4,11-dimethyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide;ethane |
| SMILES | CC.CCOCCCN1C(=O)c2cc3oc(C)cc3n2CC1(C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C23H33N3O4.C2H6/c1-4-29-12-8-11-26-21(27)19-14-20-18(13-16(2)30-20)25(19)15-23(26,3)22(28)24-17-9-6-5-7-10-17;1-2/h13-14,17H,4-12,15H2,1-3H3,(H,24,28);1-2H3 |
| InChIKey | IFXKNRNDHKLDML-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|