C28H44N4O3 — CID 92721561
(11S)-N-cycloheptyl-10-[3-(dipropylamino)propyl]-4,11-dimethyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 92721561) has the molecular formula C28H44N4O3 and a molecular weight of 484.69 g/mol. Its IUPAC name is (11S)-N-cycloheptyl-10-[3-(dipropylamino)propyl]-4,11-dimethyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | (11S)-N-cycloheptyl-10-[3-(dipropylamino)propyl]-4,11-dimethyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 92721561 |
| Molecular Formula | C28H44N4O3 |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | (11S)-N-cycloheptyl-10-[3-(dipropylamino)propyl]-4,11-dimethyl-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | CCCN(CCC)CCCN1C(=O)c2cc3oc(C)cc3n2C[C@@]1(C)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C28H44N4O3/c1-5-14-30(15-6-2)16-11-17-32-26(33)24-19-25-23(18-21(3)35-25)31(24)20-28(32,4)27(34)29-22-12-9-7-8-10-13-22/h18-19,22H,5-17,20H2,1-4H3,(H,29,34)/t28-/m0/s1 |
| InChIKey | COLNUTAVPCPEIV-NDEPHWFRSA-N |
| XLogP | 5.11 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |