C13H18O5S — CID 14313288
[(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 14313288) has the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. Its IUPAC name is [(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14313288 |
| Molecular Formula | C13H18O5S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | [(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2C[C@@H](O)[C@H](C)O2)cc1 |
| InChI | InChI=1S/C13H18O5S/c1-9-3-5-12(6-4-9)19(15,16)17-8-11-7-13(14)10(2)18-11/h3-6,10-11,13-14H,7-8H2,1-2H3/t10-,11-,13+/m0/s1 |
| InChIKey | ZQYOKEWHSHUDHH-GMXVVIOVSA-N |
| XLogP | 1.24 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|