About (2-morpholin-4-yl-2-oxoethyl) N-[1-(6-fluoro-1,3-benzoxazol-2-yl)-1-oxopropan-2-yl]carbamate
(2-morpholin-4-yl-2-oxoethyl) N-[1-(6-fluoro-1,3-benzoxazol-2-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 143134052) has the molecular formula C17H18FN3O6
and a molecular weight of 379.34 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) N-[1-(6-fluoro-1,3-benzoxazol-2-yl)-1-oxopropan-2-yl]carbamate.
Molecular Properties
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) N-[1-(6-fluoro-1,3-benzoxazol-2-yl)-1-oxopropan-2-yl]carbamate |
| PubChem CID | 143134052 |
| Molecular Formula | C17H18FN3O6 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) N-[1-(6-fluoro-1,3-benzoxazol-2-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | CC(NC(=O)OCC(=O)N1CCOCC1)C(=O)c1nc2ccc(F)cc2o1 |
| InChI | InChI=1S/C17H18FN3O6/c1-10(15(23)16-20-12-3-2-11(18)8-13(12)27-16)19-17(24)26-9-14(22)21-4-6-25-7-5-21/h2-3,8,10H,4-7,9H2,1H3,(H,19,24) |
| InChIKey | WXCFRCSVIPFIBQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2-morpholin-4-yl-2-oxoethyl) N-[1-(6-fluoro-1,3-benzoxazol-2-yl)-1-oxopropan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-morpholin-4-yl-2-oxoethyl) N-[1-(6-fluoro-1,3-benzoxazol-2-yl)-1-oxopropan-2-yl]carbamate?
The IUPAC name of (2-morpholin-4-yl-2-oxoethyl) N-[1-(6-fluoro-1,3-benzoxazol-2-yl)-1-oxopropan-2-yl]carbamate (CID 143134052) is (2-morpholin-4-yl-2-oxoethyl) N-[1-(6-fluoro-1,3-benzoxazol-2-yl)-1-oxopropan-2-yl]carbamate.
What is the SMILES notation for (2-morpholin-4-yl-2-oxoethyl) N-[1-(6-fluoro-1,3-benzoxazol-2-yl)-1-oxopropan-2-yl]carbamate?
The canonical SMILES for (2-morpholin-4-yl-2-oxoethyl) N-[1-(6-fluoro-1,3-benzoxazol-2-yl)-1-oxopropan-2-yl]carbamate is CC(NC(=O)OCC(=O)N1CCOCC1)C(=O)c1nc2ccc(F)cc2o1.
What is the InChIKey of (2-morpholin-4-yl-2-oxoethyl) N-[1-(6-fluoro-1,3-benzoxazol-2-yl)-1-oxopropan-2-yl]carbamate?
The InChIKey is WXCFRCSVIPFIBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FN3O6/c1-10(15(23)16-20-12-3-2-11(18)8-13(12)27-16)19-17(24)26-9-14(22)21-4-6-25-7-5-21/h2-3,8,10H,4-7,9H2,1H3,(H,19,24).
What are the key properties of (2-morpholin-4-yl-2-oxoethyl) N-[1-(6-fluoro-1,3-benzoxazol-2-yl)-1-oxopropan-2-yl]carbamate?
(2-morpholin-4-yl-2-oxoethyl) N-[1-(6-fluoro-1,3-benzoxazol-2-yl)-1-oxopropan-2-yl]carbamate has a molecular weight of 379.34 g/mol, XLogP of 1.12, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-morpholin-4-yl-2-oxoethyl) N-[1-(6-fluoro-1,3-benzoxazol-2-yl)-1-oxopropan-2-yl]carbamate is sourced from PubChem (CID 143134052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).