C13H20O — CID 143137863
ethane;8-methyl-2,3,4,8-tetrahydrocyclohepta[b]pyran (PubChem CID 143137863) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is ethane;8-methyl-2,3,4,8-tetrahydrocyclohepta[b]pyran.
| Compound Name | ethane;8-methyl-2,3,4,8-tetrahydrocyclohepta[b]pyran |
|---|---|
| PubChem CID | 143137863 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | ethane;8-methyl-2,3,4,8-tetrahydrocyclohepta[b]pyran |
| SMILES | CC.CC1C=CC=C2CCCOC2=C1 |
| InChI | InChI=1S/C11H14O.C2H6/c1-9-4-2-5-10-6-3-7-12-11(10)8-9;1-2/h2,4-5,8-9H,3,6-7H2,1H3;1-2H3 |
| InChIKey | DSXFSUGXNALHPI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |