methyl 4-methoxy-2,7-dimethylindole-1-carboxylate

C13H15NO3 — CID 143138095

IUPACmethyl 4-methoxy-2,7-dimethylindole-1-carboxylate
SMILESCOC(=O)n1c(C)cc2c(OC)ccc(C)c21
InChIInChI=1S/C13H15NO3/c1-8-5-6-11(16-3)10-7-9(2)14(12(8)10)13(15)17-4/h5-7H,1-4H3
InChIKeyCIFQQPZFHISWOP-UHFFFAOYSA-N
MW233.27 g/mol
LogP2.88
Rot. Bonds1

About methyl 4-methoxy-2,7-dimethylindole-1-carboxylate

methyl 4-methoxy-2,7-dimethylindole-1-carboxylate (PubChem CID 143138095) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is methyl 4-methoxy-2,7-dimethylindole-1-carboxylate.

Molecular Properties

Compound Namemethyl 4-methoxy-2,7-dimethylindole-1-carboxylate
PubChem CID143138095
Molecular FormulaC13H15NO3
Molecular Weight233.27 g/mol
Exact Mass233.11
IUPAC Namemethyl 4-methoxy-2,7-dimethylindole-1-carboxylate
SMILESCOC(=O)n1c(C)cc2c(OC)ccc(C)c21
InChIInChI=1S/C13H15NO3/c1-8-5-6-11(16-3)10-7-9(2)14(12(8)10)13(15)17-4/h5-7H,1-4H3
InChIKeyCIFQQPZFHISWOP-UHFFFAOYSA-N
XLogP2.88
TPSA40.46 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.27
LogP ≤ 52.88
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 4-methoxy-2,7-dimethylindole-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-methoxy-2,7-dimethylindole-1-carboxylate?
The IUPAC name of methyl 4-methoxy-2,7-dimethylindole-1-carboxylate (CID 143138095) is methyl 4-methoxy-2,7-dimethylindole-1-carboxylate.
What is the SMILES notation for methyl 4-methoxy-2,7-dimethylindole-1-carboxylate?
The canonical SMILES for methyl 4-methoxy-2,7-dimethylindole-1-carboxylate is COC(=O)n1c(C)cc2c(OC)ccc(C)c21.
What is the InChIKey of methyl 4-methoxy-2,7-dimethylindole-1-carboxylate?
The InChIKey is CIFQQPZFHISWOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-8-5-6-11(16-3)10-7-9(2)14(12(8)10)13(15)17-4/h5-7H,1-4H3.
What are the key properties of methyl 4-methoxy-2,7-dimethylindole-1-carboxylate?
methyl 4-methoxy-2,7-dimethylindole-1-carboxylate has a molecular weight of 233.27 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methoxy-2,7-dimethylindole-1-carboxylate is sourced from PubChem (CID 143138095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).