C12H12NO4- — CID 6953965
4,7-dimethoxy-1-methylindole-2-carboxylate (PubChem CID 6953965) has the molecular formula C12H12NO4- and a molecular weight of 234.23 g/mol. Its IUPAC name is 4,7-dimethoxy-1-methylindole-2-carboxylate.
| Compound Name | 4,7-dimethoxy-1-methylindole-2-carboxylate |
|---|---|
| PubChem CID | 6953965 |
| Molecular Formula | C12H12NO4- |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 4,7-dimethoxy-1-methylindole-2-carboxylate |
| SMILES | COc1ccc(OC)c2c1cc(C(=O)[O-])n2C |
| InChI | InChI=1S/C12H13NO4/c1-13-8(12(14)15)6-7-9(16-2)4-5-10(17-3)11(7)13/h4-6H,1-3H3,(H,14,15)/p-1 |
| InChIKey | CEUWDWAXFLFQHR-UHFFFAOYSA-M |
| XLogP | 0.56 |
| TPSA | 63.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |