C16H20N2O4 — CID 86207297
(4,7-dimethoxy-1-methylindol-2-yl)-morpholin-4-ylmethanone (PubChem CID 86207297) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is (4,7-dimethoxy-1-methylindol-2-yl)-morpholin-4-ylmethanone.
| Compound Name | (4,7-dimethoxy-1-methylindol-2-yl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 86207297 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (4,7-dimethoxy-1-methylindol-2-yl)-morpholin-4-ylmethanone |
| SMILES | COc1ccc(OC)c2c1cc(C(=O)N1CCOCC1)n2C |
| InChI | InChI=1S/C16H20N2O4/c1-17-12(16(19)18-6-8-22-9-7-18)10-11-13(20-2)4-5-14(21-3)15(11)17/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | VZONLSMDIBKNCY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |