About ethane;ethene;2-(oxan-4-yl)propan-1-ol
ethane;ethene;2-(oxan-4-yl)propan-1-ol (PubChem CID 143139632) has the molecular formula C12H26O2
and a molecular weight of 202.34 g/mol. Its IUPAC name is ethane;ethene;2-(oxan-4-yl)propan-1-ol.
Molecular Properties
| Compound Name | ethane;ethene;2-(oxan-4-yl)propan-1-ol |
| PubChem CID | 143139632 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | ethane;ethene;2-(oxan-4-yl)propan-1-ol |
| SMILES | C=C.CC.CC(CO)C1CCOCC1 |
| InChI | InChI=1S/C8H16O2.C2H6.C2H4/c1-7(6-9)8-2-4-10-5-3-8;2*1-2/h7-9H,2-6H2,1H3;1-2H3;1-2H2 |
| InChIKey | QGNUJEIIOQFULW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethene;2-(oxan-4-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethene;2-(oxan-4-yl)propan-1-ol?
The IUPAC name of ethane;ethene;2-(oxan-4-yl)propan-1-ol (CID 143139632) is ethane;ethene;2-(oxan-4-yl)propan-1-ol.
What is the SMILES notation for ethane;ethene;2-(oxan-4-yl)propan-1-ol?
The canonical SMILES for ethane;ethene;2-(oxan-4-yl)propan-1-ol is C=C.CC.CC(CO)C1CCOCC1.
What is the InChIKey of ethane;ethene;2-(oxan-4-yl)propan-1-ol?
The InChIKey is QGNUJEIIOQFULW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C2H6.C2H4/c1-7(6-9)8-2-4-10-5-3-8;2*1-2/h7-9H,2-6H2,1H3;1-2H3;1-2H2.
What are the key properties of ethane;ethene;2-(oxan-4-yl)propan-1-ol?
ethane;ethene;2-(oxan-4-yl)propan-1-ol has a molecular weight of 202.34 g/mol, XLogP of 2.87, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethene;2-(oxan-4-yl)propan-1-ol is sourced from PubChem (CID 143139632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).