C24H17F6N5S — CID 143140213
1-N-[3,5-bis(trifluoromethyl)phenyl]sulfanyl-4-methyl-3-N-(3-pyrimidin-4-yl-2-pyridinyl)benzene-1,3-diamine (PubChem CID 143140213) has the molecular formula C24H17F6N5S and a molecular weight of 521.49 g/mol. Its IUPAC name is 1-N-[3,5-bis(trifluoromethyl)phenyl]sulfanyl-4-methyl-3-N-(3-pyrimidin-4-yl-2-pyridinyl)benzene-1,3-diamine.
| Compound Name | 1-N-[3,5-bis(trifluoromethyl)phenyl]sulfanyl-4-methyl-3-N-(3-pyrimidin-4-yl-2-pyridinyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 143140213 |
| Molecular Formula | C24H17F6N5S |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | 1-N-[3,5-bis(trifluoromethyl)phenyl]sulfanyl-4-methyl-3-N-(3-pyrimidin-4-yl-2-pyridinyl)benzene-1,3-diamine |
| SMILES | Cc1ccc(NSc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1Nc1ncccc1-c1ccncn1 |
| InChI | InChI=1S/C24H17F6N5S/c1-14-4-5-17(35-36-18-10-15(23(25,26)27)9-16(11-18)24(28,29)30)12-21(14)34-22-19(3-2-7-32-22)20-6-8-31-13-33-20/h2-13,35H,1H3,(H,32,34) |
| InChIKey | CEPKXVDULNUJJY-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|