C23H19ClN4O2S — CID 58396237
N-[5-[(4-chlorophenyl)sulfonylmethyl]-2-methylphenyl]-3-pyrimidin-4-ylpyridin-2-amine (PubChem CID 58396237) has the molecular formula C23H19ClN4O2S and a molecular weight of 450.95 g/mol. Its IUPAC name is N-[5-[(4-chlorophenyl)sulfonylmethyl]-2-methylphenyl]-3-pyrimidin-4-ylpyridin-2-amine.
| Compound Name | N-[5-[(4-chlorophenyl)sulfonylmethyl]-2-methylphenyl]-3-pyrimidin-4-ylpyridin-2-amine |
|---|---|
| PubChem CID | 58396237 |
| Molecular Formula | C23H19ClN4O2S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | N-[5-[(4-chlorophenyl)sulfonylmethyl]-2-methylphenyl]-3-pyrimidin-4-ylpyridin-2-amine |
| SMILES | Cc1ccc(CS(=O)(=O)c2ccc(Cl)cc2)cc1Nc1ncccc1-c1ccncn1 |
| InChI | InChI=1S/C23H19ClN4O2S/c1-16-4-5-17(14-31(29,30)19-8-6-18(24)7-9-19)13-22(16)28-23-20(3-2-11-26-23)21-10-12-25-15-27-21/h2-13,15H,14H2,1H3,(H,26,28) |
| InChIKey | ZRJWBRQQMVNEJU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |