C16H36N2O — CID 143141942
1-[3,3-dimethyl-2-(methylamino)butyl]piperidin-2-one;ethane (PubChem CID 143141942) has the molecular formula C16H36N2O and a molecular weight of 272.48 g/mol. Its IUPAC name is 1-[3,3-dimethyl-2-(methylamino)butyl]piperidin-2-one;ethane.
| Compound Name | 1-[3,3-dimethyl-2-(methylamino)butyl]piperidin-2-one;ethane |
|---|---|
| PubChem CID | 143141942 |
| Molecular Formula | C16H36N2O |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.28 |
| IUPAC Name | 1-[3,3-dimethyl-2-(methylamino)butyl]piperidin-2-one;ethane |
| SMILES | CC.CC.CNC(CN1CCCCC1=O)C(C)(C)C |
| InChI | InChI=1S/C12H24N2O.2C2H6/c1-12(2,3)10(13-4)9-14-8-6-5-7-11(14)15;2*1-2/h10,13H,5-9H2,1-4H3;2*1-2H3 |
| InChIKey | ZWVVIQJDXVCXKN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |