C15H36N2OS — CID 143195967
ethane;N,3,3-trimethyl-1-(1-oxothiazinan-2-yl)butan-2-amine (PubChem CID 143195967) has the molecular formula C15H36N2OS and a molecular weight of 292.53 g/mol. Its IUPAC name is ethane;N,3,3-trimethyl-1-(1-oxothiazinan-2-yl)butan-2-amine.
| Compound Name | ethane;N,3,3-trimethyl-1-(1-oxothiazinan-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 143195967 |
| Molecular Formula | C15H36N2OS |
| Molecular Weight | 292.53 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | ethane;N,3,3-trimethyl-1-(1-oxothiazinan-2-yl)butan-2-amine |
| SMILES | CC.CC.CNC(CN1CCCCS1=O)C(C)(C)C |
| InChI | InChI=1S/C11H24N2OS.2C2H6/c1-11(2,3)10(12-4)9-13-7-5-6-8-15(13)14;2*1-2/h10,12H,5-9H2,1-4H3;2*1-2H3 |
| InChIKey | NVMCINGDWYYAOH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |