C13H22F3N5 — CID 64577036
N,3,3-trimethyl-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-2-amine (PubChem CID 64577036) has the molecular formula C13H22F3N5 and a molecular weight of 305.35 g/mol. Its IUPAC name is N,3,3-trimethyl-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-2-amine.
| Compound Name | N,3,3-trimethyl-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-2-amine |
|---|---|
| PubChem CID | 64577036 |
| Molecular Formula | C13H22F3N5 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | N,3,3-trimethyl-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-2-amine |
| SMILES | CNC(CN1CCn2c(nnc2C(F)(F)F)C1)C(C)(C)C |
| InChI | InChI=1S/C13H22F3N5/c1-12(2,3)9(17-4)7-20-5-6-21-10(8-20)18-19-11(21)13(14,15)16/h9,17H,5-8H2,1-4H3 |
| InChIKey | JBYACHIHTLJGGC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |