C10H14BrF3N4 — CID 64580179
7-(4-bromobutyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 64580179) has the molecular formula C10H14BrF3N4 and a molecular weight of 327.15 g/mol. Its IUPAC name is 7-(4-bromobutyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 7-(4-bromobutyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 64580179 |
| Molecular Formula | C10H14BrF3N4 |
| Molecular Weight | 327.15 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 7-(4-bromobutyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | FC(F)(F)c1nnc2n1CCN(CCCCBr)C2 |
| InChI | InChI=1S/C10H14BrF3N4/c11-3-1-2-4-17-5-6-18-8(7-17)15-16-9(18)10(12,13)14/h1-7H2 |
| InChIKey | VDVSYNFHGAZMCD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.15 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|