C7H8BrF3N4O2S — CID 83085769
7-(bromomethylsulfonyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 83085769) has the molecular formula C7H8BrF3N4O2S and a molecular weight of 349.13 g/mol. Its IUPAC name is 7-(bromomethylsulfonyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 7-(bromomethylsulfonyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 83085769 |
| Molecular Formula | C7H8BrF3N4O2S |
| Molecular Weight | 349.13 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | 7-(bromomethylsulfonyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | O=S(=O)(CBr)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C7H8BrF3N4O2S/c8-4-18(16,17)14-1-2-15-5(3-14)12-13-6(15)7(9,10)11/h1-4H2 |
| InChIKey | DNRQIDMVPFHMDE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.13 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|