C32H54O3 — CID 143142099
[(4aR,4bR,6aR,10aR,10bR,12aR)-8-hydroxy-4a,4b,7,7,10a-pentamethyl-1-(2-methylpent-1-en-3-yl)-1,2,3,4,5,6,6a,8,9,10,10b,11,12,12a-tetradecahydrochrysen-2-yl]methyl acetate (PubChem CID 143142099) has the molecular formula C32H54O3 and a molecular weight of 486.78 g/mol. Its IUPAC name is [(4aR,4bR,6aR,10aR,10bR,12aR)-8-hydroxy-4a,4b,7,7,10a-pentamethyl-1-(2-methylpent-1-en-3-yl)-1,2,3,4,5,6,6a,8,9,10,10b,11,12,12a-tetradecahydrochrysen-2-yl]methyl acetate.
| Compound Name | [(4aR,4bR,6aR,10aR,10bR,12aR)-8-hydroxy-4a,4b,7,7,10a-pentamethyl-1-(2-methylpent-1-en-3-yl)-1,2,3,4,5,6,6a,8,9,10,10b,11,12,12a-tetradecahydrochrysen-2-yl]methyl acetate |
|---|---|
| PubChem CID | 143142099 |
| Molecular Formula | C32H54O3 |
| Molecular Weight | 486.78 g/mol |
| Exact Mass | 486.41 |
| IUPAC Name | [(4aR,4bR,6aR,10aR,10bR,12aR)-8-hydroxy-4a,4b,7,7,10a-pentamethyl-1-(2-methylpent-1-en-3-yl)-1,2,3,4,5,6,6a,8,9,10,10b,11,12,12a-tetradecahydrochrysen-2-yl]methyl acetate |
| SMILES | C=C(C)C(CC)C1C(COC(C)=O)CC[C@]2(C)[C@@H]1CC[C@@H]1[C@@]3(C)CCC(O)C(C)(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C32H54O3/c1-10-23(20(2)3)28-22(19-35-21(4)33)13-17-31(8)24(28)11-12-26-30(7)16-15-27(34)29(5,6)25(30)14-18-32(26,31)9/h22-28,34H,2,10-19H2,1,3-9H3/t22?,23?,24-,25+,26-,27?,28?,30+,31-,32-/m1/s1 |
| InChIKey | VPQZBXKXYVEMSU-VJTRXUAESA-N |
| XLogP | 7.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.78 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|