C32H39N5O8 — CID 143142361
4-[[(4S)-4-(3-carboxypropanoylamino)-5-oxo-5-[[2-oxo-2-(quinolin-3-ylamino)ethyl]amino]pentyl]amino]-4-oxobutanoic acid;ethylbenzene (PubChem CID 143142361) has the molecular formula C32H39N5O8 and a molecular weight of 621.69 g/mol. Its IUPAC name is 4-[[(4S)-4-(3-carboxypropanoylamino)-5-oxo-5-[[2-oxo-2-(quinolin-3-ylamino)ethyl]amino]pentyl]amino]-4-oxobutanoic acid;ethylbenzene.
| Compound Name | 4-[[(4S)-4-(3-carboxypropanoylamino)-5-oxo-5-[[2-oxo-2-(quinolin-3-ylamino)ethyl]amino]pentyl]amino]-4-oxobutanoic acid;ethylbenzene |
|---|---|
| PubChem CID | 143142361 |
| Molecular Formula | C32H39N5O8 |
| Molecular Weight | 621.69 g/mol |
| Exact Mass | 621.28 |
| IUPAC Name | 4-[[(4S)-4-(3-carboxypropanoylamino)-5-oxo-5-[[2-oxo-2-(quinolin-3-ylamino)ethyl]amino]pentyl]amino]-4-oxobutanoic acid;ethylbenzene |
| SMILES | CCc1ccccc1.O=C(O)CCC(=O)NCCC[C@H](NC(=O)CCC(=O)O)C(=O)NCC(=O)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C24H29N5O8.C8H10/c30-19(7-9-22(33)34)25-11-3-6-18(29-20(31)8-10-23(35)36)24(37)27-14-21(32)28-16-12-15-4-1-2-5-17(15)26-13-16;1-2-8-6-4-3-5-7-8/h1-2,4-5,12-13,18H,3,6-11,14H2,(H,25,30)(H,27,37)(H,28,32)(H,29,31)(H,33,34)(H,35,36);3-7H,2H2,1H3/t18-;/m0./s1 |
| InChIKey | BHRUCFLQGBPMOX-FERBBOLQSA-N |
| XLogP | 2.65 |
| TPSA | 203.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.69 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|